About azane;porphyrin;zinc
azane;porphyrin;zinc (PubChem CID 175189191) has the molecular formula C20H15N5Zn
and a molecular weight of 390.77 g/mol. Its IUPAC name is azane;porphyrin;zinc.
Molecular Properties
| Compound Name | azane;porphyrin;zinc |
| PubChem CID | 175189191 |
| Molecular Formula | C20H15N5Zn |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | azane;porphyrin;zinc |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.N.[Zn] |
| InChI | InChI=1S/C20H12N4.H3N.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;/h1-12H;1H3;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | ILVSXKJUIQONRY-IAULSPAKSA-N |
| XLogP | 3.74 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;porphyrin;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;porphyrin;zinc?
The IUPAC name of azane;porphyrin;zinc (CID 175189191) is azane;porphyrin;zinc.
What is the SMILES notation for azane;porphyrin;zinc?
The canonical SMILES for azane;porphyrin;zinc is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.N.[Zn].
What is the InChIKey of azane;porphyrin;zinc?
The InChIKey is ILVSXKJUIQONRY-IAULSPAKSA-N. The full InChI is InChI=1S/C20H12N4.H3N.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;/h1-12H;1H3;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of azane;porphyrin;zinc?
azane;porphyrin;zinc has a molecular weight of 390.77 g/mol, XLogP of 3.74, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;porphyrin;zinc is sourced from PubChem (CID 175189191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).