C20H10Br2N4 — CID 66625695
2,3-dibromoporphyrin (PubChem CID 66625695) has the molecular formula C20H10Br2N4 and a molecular weight of 466.14 g/mol. Its IUPAC name is 2,3-dibromoporphyrin.
| Compound Name | 2,3-dibromoporphyrin |
|---|---|
| PubChem CID | 66625695 |
| Molecular Formula | C20H10Br2N4 |
| Molecular Weight | 466.14 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | 2,3-dibromoporphyrin |
| SMILES | BrC1=C(Br)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C20H10Br2N4/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10H/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10- |
| InChIKey | LCNOQSVXIULTAQ-ITJRXXQTSA-N |
| XLogP | 5.02 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |