About 2-(bromomethyl)porphyrin
2-(bromomethyl)porphyrin (PubChem CID 66692696) has the molecular formula C21H13BrN4
and a molecular weight of 401.27 g/mol. Its IUPAC name is 2-(bromomethyl)porphyrin.
Molecular Properties
| Compound Name | 2-(bromomethyl)porphyrin |
| PubChem CID | 66692696 |
| Molecular Formula | C21H13BrN4 |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-(bromomethyl)porphyrin |
| SMILES | BrCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C21H13BrN4/c22-12-13-7-20-10-18-4-3-16(24-18)8-14-1-2-15(23-14)9-17-5-6-19(25-17)11-21(13)26-20/h1-11H,12H2/b14-8-,15-9-,16-8-,17-9-,18-10-,19-11-,20-10-,21-11- |
| InChIKey | FUZCSLSBILWURK-YLHWRNOOSA-N |
| XLogP | 4.34 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)porphyrin?
The IUPAC name of 2-(bromomethyl)porphyrin (CID 66692696) is 2-(bromomethyl)porphyrin.
What is the SMILES notation for 2-(bromomethyl)porphyrin?
The canonical SMILES for 2-(bromomethyl)porphyrin is BrCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-(bromomethyl)porphyrin?
The InChIKey is FUZCSLSBILWURK-YLHWRNOOSA-N. The full InChI is InChI=1S/C21H13BrN4/c22-12-13-7-20-10-18-4-3-16(24-18)8-14-1-2-15(23-14)9-17-5-6-19(25-17)11-21(13)26-20/h1-11H,12H2/b14-8-,15-9-,16-8-,17-9-,18-10-,19-11-,20-10-,21-11-.
What are the key properties of 2-(bromomethyl)porphyrin?
2-(bromomethyl)porphyrin has a molecular weight of 401.27 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)porphyrin is sourced from PubChem (CID 66692696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).