C32H28N2Se — CID 11318351
4,15-diethyl-5,14-dimethyl-28-selena-27,29-diazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene (PubChem CID 11318351) has the molecular formula C32H28N2Se and a molecular weight of 519.55 g/mol. Its IUPAC name is 4,15-diethyl-5,14-dimethyl-28-selena-27,29-diazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene.
| Compound Name | 4,15-diethyl-5,14-dimethyl-28-selena-27,29-diazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene |
|---|---|
| PubChem CID | 11318351 |
| Molecular Formula | C32H28N2Se |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4,15-diethyl-5,14-dimethyl-28-selena-27,29-diazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene |
| SMILES | CCC1=C(C)C2=N/C1=C\c1cc(c3cccccc1-3)/C=C1\N=C(/C=c3/cc/c([se]3)=C/2)C(C)=C1CC |
| InChI | InChI=1S/C32H28N2Se/c1-5-25-19(3)29-17-23-12-13-24(35-23)18-30-20(4)26(6-2)32(34-30)16-22-14-21(15-31(25)33-29)27-10-8-7-9-11-28(22)27/h7-18H,5-6H2,1-4H3/b23-17-,24-18-,31-15-,32-16- |
| InChIKey | DUTWBSUPCYOXMV-UXZGBKTHSA-N |
| XLogP | 6.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|