C41H49N3O2 — CID 10886634
5,9,10,14-tetraethyl-4,15-dimethyl-25,25-di(propan-2-yloxy)-26,27,28-triazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene (PubChem CID 10886634) has the molecular formula C41H49N3O2 and a molecular weight of 615.86 g/mol. Its IUPAC name is 5,9,10,14-tetraethyl-4,15-dimethyl-25,25-di(propan-2-yloxy)-26,27,28-triazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene.
| Compound Name | 5,9,10,14-tetraethyl-4,15-dimethyl-25,25-di(propan-2-yloxy)-26,27,28-triazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 10886634 |
| Molecular Formula | C41H49N3O2 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.38 |
| IUPAC Name | 5,9,10,14-tetraethyl-4,15-dimethyl-25,25-di(propan-2-yloxy)-26,27,28-triazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3(28),4,6,8,10,12,14,16(26),17,19,21,23-tridecaene |
| SMILES | CCC1=C(C)C2=N/C1=C\c1[nH]c(c(CC)c1CC)/C=C1\N=C(/C=C3/c4ccccc4/C(=C/2)C3(OC(C)C)OC(C)C)C(C)=C1CC |
| InChI | InChI=1S/C41H49N3O2/c1-11-27-25(9)35-19-33-31-17-15-16-18-32(31)34(41(33,45-23(5)6)46-24(7)8)20-36-26(10)28(12-2)38(43-36)22-40-30(14-4)29(13-3)39(44-40)21-37(27)42-35/h15-24,44H,11-14H2,1-10H3/b33-19-,34-20-,35-19-,36-20-,37-21-,38-22-,39-21-,40-22- |
| InChIKey | ODTUMQSQXUPFGF-UFRVCQEYSA-N |
| XLogP | 10.22 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|