C37H46N4O2 — CID 136786573
2,3,7,8,12,13,17,18-octaethyl-15-(hydroxymethylidene)-21,22-dihydroporphyrin-5-one (PubChem CID 136786573) has the molecular formula C37H46N4O2 and a molecular weight of 578.80 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-15-(hydroxymethylidene)-21,22-dihydroporphyrin-5-one.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-15-(hydroxymethylidene)-21,22-dihydroporphyrin-5-one |
|---|---|
| PubChem CID | 136786573 |
| Molecular Formula | C37H46N4O2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-15-(hydroxymethylidene)-21,22-dihydroporphyrin-5-one |
| SMILES | CCC1=C(CC)/C2=C/c3[nH]c(c(CC)c3CC)C(=O)c3[nH]c(c(CC)c3CC)/C=C3\N=C(C(=CO)C1=N2)C(CC)=C3CC |
| InChI | InChI=1S/C37H46N4O2/c1-9-20-24(13-5)33-28(19-42)34-25(14-6)21(10-2)30(39-34)18-32-23(12-4)27(16-8)36(41-32)37(43)35-26(15-7)22(11-3)31(40-35)17-29(20)38-33/h17-19,40-42H,9-16H2,1-8H3/b29-17-,30-18- |
| InChIKey | KTFIXVYPKWVWOH-LZUTUTKMSA-N |
| XLogP | 9.10 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|