C36H44MgN4 — CID 6327391
Magnesium,[2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphinato(2-)-N21,N22,N23,N24]-(SP-4-1)- (PubChem CID 6327391) has the molecular formula C36H44MgN4 and a molecular weight of 557.08 g/mol.
| Compound Name | Magnesium,[2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphinato(2-)-N21,N22,N23,N24]-(SP-4-1)- |
|---|---|
| PubChem CID | 6327391 |
| Molecular Formula | C36H44MgN4 |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | — |
| SMILES | CCC1=C2/C=C3\N=C(/C=C4\[N]/C(=C\C5=N/C(=C\C(=C1CC)[N]2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC.[Mg] |
| InChI | InChI=1S/C36H44N4.Mg/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | CNFQCFRYAAADBB-XTPDIVBZSA-N |
| XLogP | 8.98 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |