C36H45N4Pd-3 — CID 59413512
(4Z,10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1H-porphyrin-21,22,24-triide;palladium (PubChem CID 59413512) has the molecular formula C36H45N4Pd-3 and a molecular weight of 640.20 g/mol. Its IUPAC name is (4Z,10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1H-porphyrin-21,22,24-triide;palladium.
| Compound Name | (4Z,10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1H-porphyrin-21,22,24-triide;palladium |
|---|---|
| PubChem CID | 59413512 |
| Molecular Formula | C36H45N4Pd-3 |
| Molecular Weight | 640.20 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | (4Z,10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1H-porphyrin-21,22,24-triide;palladium |
| SMILES | CCC1=C(CC)/C2=C/c3[n-]c(c(CC)c3CC)/C=C3\[N-]C(/C=c4\[n-]/c(c(CC)c4CC)=C\C1=N2)C(CC)=C3CC.[Pd] |
| InChI | InChI=1S/C36H45N4.Pd/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20,29H,9-16H2,1-8H3;/q-3;/b30-18-,31-17-,33-19-,36-20-; |
| InChIKey | QHZWKCYLFPHTNP-VDNKUEHESA-N |
| XLogP | 7.25 |
| TPSA | 54.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.20 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |