C35H44N4 — CID 161120870
2,7,8,12,13,17,18-heptaethyl-3-methyl-1,23-dihydroporphyrin (PubChem CID 161120870) has the molecular formula C35H44N4 and a molecular weight of 520.77 g/mol. Its IUPAC name is 2,7,8,12,13,17,18-heptaethyl-3-methyl-1,23-dihydroporphyrin.
| Compound Name | 2,7,8,12,13,17,18-heptaethyl-3-methyl-1,23-dihydroporphyrin |
|---|---|
| PubChem CID | 161120870 |
| Molecular Formula | C35H44N4 |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 2,7,8,12,13,17,18-heptaethyl-3-methyl-1,23-dihydroporphyrin |
| SMILES | CCC1=C(CC)C2=NC1=CC1=NC(C=C3N=C(C=c4[nH]c(c(CC)c4CC)=C2)C(CC)=C3CC)C(CC)=C1C |
| InChI | InChI=1S/C35H44N4/c1-9-21-20(8)28-16-30-22(10-2)23(11-3)32(37-30)18-34-26(14-6)27(15-7)35(39-34)19-33-25(13-5)24(12-4)31(38-33)17-29(21)36-28/h16-19,29,39H,9-15H2,1-8H3 |
| InChIKey | OZLFBUICYNLQKV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |