C36H45ClN4O — CID 137271346
5-chloro-3,3,7,8,12,13,17,18-octaethyl-21H-porphyrin-2-ol (PubChem CID 137271346) has the molecular formula C36H45ClN4O and a molecular weight of 585.24 g/mol. Its IUPAC name is 5-chloro-3,3,7,8,12,13,17,18-octaethyl-21H-porphyrin-2-ol.
| Compound Name | 5-chloro-3,3,7,8,12,13,17,18-octaethyl-21H-porphyrin-2-ol |
|---|---|
| PubChem CID | 137271346 |
| Molecular Formula | C36H45ClN4O |
| Molecular Weight | 585.24 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 5-chloro-3,3,7,8,12,13,17,18-octaethyl-21H-porphyrin-2-ol |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=C(O)C(CC)(CC)/C(=C(\Cl)C5=N/C(=C\C1=N2)C(CC)=C5CC)N4)C(CC)=C3CC |
| InChI | InChI=1S/C36H45ClN4O/c1-9-20-21(10-2)28-18-30-24(13-5)25(14-6)33(40-30)32(37)34-36(15-7,16-8)35(42)31(41-34)19-29-23(12-4)22(11-3)27(39-29)17-26(20)38-28/h17-19,41-42H,9-16H2,1-8H3/b26-17-,29-19-,30-18-,34-32+ |
| InChIKey | YEMWWENFTNWXRO-NZSHMREWSA-N |
| XLogP | 9.99 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.24 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |