C36H40N4O5 — CID 135547564
methyl 3-[(8Z)-13-ethyl-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate (PubChem CID 135547564) has the molecular formula C36H40N4O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is methyl 3-[(8Z)-13-ethyl-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[(8Z)-13-ethyl-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 135547564 |
| Molecular Formula | C36H40N4O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | methyl 3-[(8Z)-13-ethyl-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate |
| SMILES | CCC1=C(C)C2=N/C1=C\C1=N/C(=C\C3=N/C(=C\c4[nH]c(/c(=C(/C)O)c4C)=C\2)C(C)=C3CCC(=O)OC)C(CCC(=O)OC)=C1C |
| InChI | InChI=1S/C36H40N4O5/c1-9-23-18(2)28-16-33-36(22(6)41)21(5)29(40-33)14-26-19(3)24(10-12-34(42)44-7)31(38-26)17-32-25(11-13-35(43)45-8)20(4)27(39-32)15-30(23)37-28/h14-17,40-41H,9-13H2,1-8H3/b26-14-,30-15-,32-17-,33-16-,36-22- |
| InChIKey | XJEUVXUQVUBZFV-VKXUOURGSA-N |
| XLogP | 5.54 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |