C34H38N4O5 — CID 173467895
methyl 3-[12-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-18-(3-methylperoxypropyl)-22H-porphyrin-2-yl]propanoate (PubChem CID 173467895) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is methyl 3-[12-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-18-(3-methylperoxypropyl)-22H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[12-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-18-(3-methylperoxypropyl)-22H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 173467895 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | methyl 3-[12-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-18-(3-methylperoxypropyl)-22H-porphyrin-2-yl]propanoate |
| SMILES | COOCCCC1=C(C)/C2=C/C3=C(C)C(=C(C)O)C(=N3)/C=c3\[nH]/c(cc3C)=C\C3=N/C(=C\C1=N2)C(CCC(=O)OC)=C3C |
| InChI | InChI=1S/C34H38N4O5/c1-18-13-23-14-27-20(3)25(10-11-33(40)41-6)31(36-27)17-30-24(9-8-12-43-42-7)19(2)28(37-30)16-29-21(4)34(22(5)39)32(38-29)15-26(18)35-23/h13-17,35,39H,8-12H2,1-7H3/b23-14-,26-15-,28-16-,31-17-,34-22? |
| InChIKey | QREOPKJCPXWDIA-YBKXJFMWSA-N |
| XLogP | 5.08 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|