C36H40N4O7 — CID 173375040
3-[18-(2-carboxyethyl)-7,12-bis(1-hydroxyethyl)-10-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid (PubChem CID 173375040) has the molecular formula C36H40N4O7 and a molecular weight of 640.74 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-7,12-bis(1-hydroxyethyl)-10-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-7,12-bis(1-hydroxyethyl)-10-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 173375040 |
| Molecular Formula | C36H40N4O7 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-7,12-bis(1-hydroxyethyl)-10-(1-hydroxyethylidene)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid |
| SMILES | CC(O)=C1C2=N/C(=C\c3[nH]c(c(CCC(=O)O)c3C)/C=C3\N=C(/C=C4\N=C1C(C(C)O)=C4C)C(C)=C3CCC(=O)O)C(C(C)O)=C2C |
| InChI | InChI=1S/C36H40N4O7/c1-15-22(8-10-30(44)45)27-14-28-23(9-11-31(46)47)16(2)25(38-28)13-29-32(19(5)41)18(4)35(40-29)34(21(7)43)36-33(20(6)42)17(3)26(39-36)12-24(15)37-27/h12-14,19-20,38,41-43H,8-11H2,1-7H3,(H,44,45)(H,46,47)/b26-12-,27-14-,29-13-,34-21? |
| InChIKey | ACNISBHDPUWOKA-KCAFNALSSA-N |
| XLogP | 5.69 |
| TPSA | 188.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|