C37H42N4O3 — CID 177091608
3-[(4Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(4-methyl-3-oxopentyl)-9,10,23,24-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 177091608) has the molecular formula C37H42N4O3 and a molecular weight of 590.77 g/mol. Its IUPAC name is 3-[(4Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(4-methyl-3-oxopentyl)-9,10,23,24-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(4Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(4-methyl-3-oxopentyl)-9,10,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 177091608 |
| Molecular Formula | C37H42N4O3 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | 3-[(4Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-(4-methyl-3-oxopentyl)-9,10,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C(C)C2Cc3[nH]c(c(C)c3C=C)/C=c3\[nH]/c(c(CCC(=O)C(C)C)c3C)=C\C3=N/C(=C\C1=N2)C(C)=C3CCC(=O)O |
| InChI | InChI=1S/C37H42N4O3/c1-9-24-20(5)28-15-29-22(7)26(11-13-36(42)19(3)4)34(40-29)18-35-27(12-14-37(43)44)23(8)31(41-35)17-33-25(10-2)21(6)30(39-33)16-32(24)38-28/h9-10,15,17-19,30,38,40H,1-2,11-14,16H2,3-8H3,(H,43,44)/b29-15-,31-17-,34-18- |
| InChIKey | CYFQIBCDDMOFIQ-DXJOJOHXSA-N |
| XLogP | 5.77 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |