C35H37FeN5O3 — CID 143862747
3-[(4Z,10Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-14,22-dihydroporphyrin-23,24-diid-2-yl]propanoic acid;iron(2+) (PubChem CID 143862747) has the molecular formula C35H37FeN5O3 and a molecular weight of 631.56 g/mol. Its IUPAC name is 3-[(4Z,10Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-14,22-dihydroporphyrin-23,24-diid-2-yl]propanoic acid;iron(2+).
| Compound Name | 3-[(4Z,10Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-14,22-dihydroporphyrin-23,24-diid-2-yl]propanoic acid;iron(2+) |
|---|---|
| PubChem CID | 143862747 |
| Molecular Formula | C35H37FeN5O3 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 3-[(4Z,10Z,15Z,19Z)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-14,22-dihydroporphyrin-23,24-diid-2-yl]propanoic acid;iron(2+) |
| SMILES | C=CC1=C(C)C2/C=c3\[n-]/c(c(CCC(=O)NC)c3C)=C\C3=N/C(=C\c4[nH]c(c(C)c4C=C)/C=C/1[N-]2)C(C)=C3CCC(=O)O.[Fe+2] |
| InChI | InChI=1S/C35H39N5O3.Fe/c1-8-22-18(3)26-14-27-20(5)24(10-12-34(41)36-7)32(39-27)17-33-25(11-13-35(42)43)21(6)29(40-33)16-31-23(9-2)19(4)28(38-31)15-30(22)37-26;/h8-9,14-17,26H,1-2,10-13H2,3-7H3,(H5,36,37,38,39,40,41,42,43);/q;+2/p-2/b27-14-; |
| InChIKey | STQWBSXGOYJNBP-JXTIHSCLSA-L |
| XLogP | 4.76 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|