C33H34FeN4O4- — CID 163118521
3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,13,17-pentamethyl-1,14-dihydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(3+) (PubChem CID 163118521) has the molecular formula C33H34FeN4O4- and a molecular weight of 606.50 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,13,17-pentamethyl-1,14-dihydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(3+).
| Compound Name | 3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,13,17-pentamethyl-1,14-dihydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(3+) |
|---|---|
| PubChem CID | 163118521 |
| Molecular Formula | C33H34FeN4O4- |
| Molecular Weight | 606.50 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8-ethenyl-3,7,12,13,17-pentamethyl-1,14-dihydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(3+) |
| SMILES | C=Cc1c2[n-]c(c1C)C=C1[N-]C(C=c3[n-]c(c(C)c3CCC(=O)O)=CC3[N-]C(=C2)C(C)=C3C)C(CCC(=O)O)=C1C.[Fe+3] |
| InChI | InChI=1S/C33H34N4O4.Fe/c1-7-21-18(4)26-13-28-20(6)23(9-11-33(40)41)31(37-28)15-30-22(8-10-32(38)39)19(5)27(36-30)12-24-16(2)17(3)25(34-24)14-29(21)35-26;/h7,12-15,24,31H,1,8-11H2,2-6H3,(H,38,39)(H,40,41);/q-4;+3 |
| InChIKey | HQKMRXZEXDBJBX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|