C36H36FeN4O8 — CID 169493499
iron(4+);3-[(1Z,4Z,10Z,14Z)-7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetramethylporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid (PubChem CID 169493499) has the molecular formula C36H36FeN4O8 and a molecular weight of 708.55 g/mol. Its IUPAC name is iron(4+);3-[(1Z,4Z,10Z,14Z)-7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetramethylporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid.
| Compound Name | iron(4+);3-[(1Z,4Z,10Z,14Z)-7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetramethylporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid |
|---|---|
| PubChem CID | 169493499 |
| Molecular Formula | C36H36FeN4O8 |
| Molecular Weight | 708.55 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | iron(4+);3-[(1Z,4Z,10Z,14Z)-7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetramethylporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid |
| SMILES | Cc1c2[n-]c(c1CCC(=O)O)/C=c1\[n-]/c(c(CCC(=O)O)c1C)=C\c1[n-]c(c(CCC(=O)O)c1C)/C=c1\[n-]/c(c(CCC(=O)O)c1C)=C\2.[Fe+4] |
| InChI | InChI=1S/C36H36N4O8.Fe/c1-17-21(5-9-33(41)42)29-14-26-19(3)23(7-11-35(45)46)31(39-26)16-28-20(4)24(8-12-36(47)48)32(40-28)15-27-18(2)22(6-10-34(43)44)30(38-27)13-25(17)37-29;/h13-16H,5-12H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48);/q-4;+4/b25-13-,26-14-,27-15-,28-16-,29-14-,30-13-,31-16-,32-15-; |
| InChIKey | UMZOSWUPJIAOPZ-MXOXSBADSA-N |
| XLogP | 0.44 |
| TPSA | 205.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.55 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|