C34H36FeN4O4-2 — CID 163158056
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,14,21,23-tetrahydroporphyrin-22,24-diid-2-yl]propanoic acid;iron dihydride (PubChem CID 163158056) has the molecular formula C34H36FeN4O4-2 and a molecular weight of 620.53 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,14,21,23-tetrahydroporphyrin-22,24-diid-2-yl]propanoic acid;iron dihydride.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,14,21,23-tetrahydroporphyrin-22,24-diid-2-yl]propanoic acid;iron dihydride |
|---|---|
| PubChem CID | 163158056 |
| Molecular Formula | C34H36FeN4O4-2 |
| Molecular Weight | 620.53 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,14,21,23-tetrahydroporphyrin-22,24-diid-2-yl]propanoic acid;iron dihydride |
| SMILES | C=CC1=C(C)C2=Cc3[n-]c(c(C)c3C=C)C=C3NC(C=c4[n-]c(c(C)c4CCC(=O)O)=CC1N2)C(CCC(=O)O)=C3C.[Fe] |
| InChI | InChI=1S/C34H36N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16,30-31,36-37H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42);/q-2; |
| InChIKey | AXEIXMAFKBLASC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|