C34H34FeN4O5 — CID 157010564
3-[(5Z,15Z,17S,18R,19Z)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[9,10-dihydroporphyrin-21,22,23,24-tetraide-18,2'-oxolane]-2-yl]propanoic acid;iron(4+) (PubChem CID 157010564) has the molecular formula C34H34FeN4O5 and a molecular weight of 634.51 g/mol. Its IUPAC name is 3-[(5Z,15Z,17S,18R,19Z)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[9,10-dihydroporphyrin-21,22,23,24-tetraide-18,2'-oxolane]-2-yl]propanoic acid;iron(4+).
| Compound Name | 3-[(5Z,15Z,17S,18R,19Z)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[9,10-dihydroporphyrin-21,22,23,24-tetraide-18,2'-oxolane]-2-yl]propanoic acid;iron(4+) |
|---|---|
| PubChem CID | 157010564 |
| Molecular Formula | C34H34FeN4O5 |
| Molecular Weight | 634.51 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 3-[(5Z,15Z,17S,18R,19Z)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[9,10-dihydroporphyrin-21,22,23,24-tetraide-18,2'-oxolane]-2-yl]propanoic acid;iron(4+) |
| SMILES | C=CC1=C(C)/C2=C/c3[n-]c(c(CCC(=O)O)c3C)/C=C3\[N-]/C(=C\c4[n-]c(c(C)c4C=C)CC1[N-]2)[C@](C)(O)[C@@]31CCC(=O)O1.[Fe+4] |
| InChI | InChI=1S/C34H34N4O5.Fe/c1-7-20-17(3)23-13-24-19(5)22(9-10-31(39)40)28(37-24)16-30-34(12-11-32(41)43-34)33(6,42)29(38-30)15-27-21(8-2)18(4)25(36-27)14-26(20)35-23;/h7-8,13,15-16,26,42H,1-2,9-12,14H2,3-6H3,(H,39,40);/q-4;+4/b23-13-,29-15-,30-16-;/t26?,33-,34+;/m0./s1 |
| InChIKey | RMHWJYWDJBATGS-CGUJVNSGSA-N |
| XLogP | 5.63 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|