C34H36FeN4O4 — CID 155487941
3-[(1R,4S,10Z,14Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,4,5,20-tetrahydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+) (PubChem CID 155487941) has the molecular formula C34H36FeN4O4 and a molecular weight of 620.53 g/mol. Its IUPAC name is 3-[(1R,4S,10Z,14Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,4,5,20-tetrahydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+).
| Compound Name | 3-[(1R,4S,10Z,14Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,4,5,20-tetrahydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+) |
|---|---|
| PubChem CID | 155487941 |
| Molecular Formula | C34H36FeN4O4 |
| Molecular Weight | 620.53 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 3-[(1R,4S,10Z,14Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-1,4,5,20-tetrahydroporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+) |
| SMILES | C=Cc1c2[n-]c(c1C)C[C@@H]1[N-][C@H](Cc3[n-]c(c(C)c3CCC(=O)O)/C=c3\[n-]/c(c(C)c3C=C)=C\2)C(CCC(=O)O)=C1C.[Fe+4] |
| InChI | InChI=1S/C34H36N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,14-15,26,31H,1-2,9-13,16H2,3-6H3,(H,39,40)(H,41,42);/q-4;+4/b27-14-,30-15-;/t26-,31+;/m0./s1 |
| InChIKey | CPFYWEMZZIPZES-BAZJXSIISA-N |
| XLogP | 3.85 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|