C34H38N4O4Zn — CID 5311295
zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-5,10,15,20,21,23-hexahydroporphyrin-22,24-diid-2-yl]propanoic acid (PubChem CID 5311295) has the molecular formula C34H38N4O4Zn and a molecular weight of 632.09 g/mol. Its IUPAC name is zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-5,10,15,20,21,23-hexahydroporphyrin-22,24-diid-2-yl]propanoic acid.
| Compound Name | zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-5,10,15,20,21,23-hexahydroporphyrin-22,24-diid-2-yl]propanoic acid |
|---|---|
| PubChem CID | 5311295 |
| Molecular Formula | C34H38N4O4Zn |
| Molecular Weight | 632.09 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-5,10,15,20,21,23-hexahydroporphyrin-22,24-diid-2-yl]propanoic acid |
| SMILES | C=Cc1c2[n-]c(c1C)Cc1[nH]c(c(CCC(=O)O)c1C)Cc1[n-]c(c(C)c1CCC(=O)O)Cc1[nH]c(c(C)c1C=C)C2.[Zn+2] |
| InChI | InChI=1S/C34H38N4O4.Zn/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,36-37H,1-2,9-16H2,3-6H3,(H,39,40)(H,41,42);/q-2;+2 |
| InChIKey | IRQJKDRVEISNKM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.09 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|