C35H40N4O4-2 — CID 91895531
3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17,23-pentamethyl-10,15,20,21-tetrahydro-5H-porphyrin-22,24-diid-2-yl]propanoic acid (PubChem CID 91895531) has the molecular formula C35H40N4O4-2 and a molecular weight of 580.73 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17,23-pentamethyl-10,15,20,21-tetrahydro-5H-porphyrin-22,24-diid-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17,23-pentamethyl-10,15,20,21-tetrahydro-5H-porphyrin-22,24-diid-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91895531 |
| Molecular Formula | C35H40N4O4-2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17,23-pentamethyl-10,15,20,21-tetrahydro-5H-porphyrin-22,24-diid-2-yl]propanoic acid |
| SMILES | C=Cc1c2[n-]c(c1C)Cc1c(C=C)c(C)c(n1C)Cc1[n-]c(c(CCC(=O)O)c1C)Cc1[nH]c(c(C)c1CCC(=O)O)C2 |
| InChI | InChI=1S/C35H40N4O4/c1-8-22-18(3)28-17-33-23(9-2)21(6)32(39(33)7)16-27-20(5)25(11-13-35(42)43)31(38-27)15-30-24(10-12-34(40)41)19(4)26(36-30)14-29(22)37-28/h8-9,36H,1-2,10-17H2,3-7H3,(H,40,41)(H,42,43)/q-2 |
| InChIKey | JYDJFLZJAPLWSD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |