C34H38FeN4O5 — CID 11957365
3-[(1Z,4Z,10Z,13R,14Z)-18-(2-carboxyethyl)-7,13-diethyl-12-hydroxy-3,8,13,17-tetramethyl-12H-porphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+) (PubChem CID 11957365) has the molecular formula C34H38FeN4O5 and a molecular weight of 638.55 g/mol. Its IUPAC name is 3-[(1Z,4Z,10Z,13R,14Z)-18-(2-carboxyethyl)-7,13-diethyl-12-hydroxy-3,8,13,17-tetramethyl-12H-porphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+).
| Compound Name | 3-[(1Z,4Z,10Z,13R,14Z)-18-(2-carboxyethyl)-7,13-diethyl-12-hydroxy-3,8,13,17-tetramethyl-12H-porphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+) |
|---|---|
| PubChem CID | 11957365 |
| Molecular Formula | C34H38FeN4O5 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | 3-[(1Z,4Z,10Z,13R,14Z)-18-(2-carboxyethyl)-7,13-diethyl-12-hydroxy-3,8,13,17-tetramethyl-12H-porphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;iron(4+) |
| SMILES | CCc1c2[n-]c(c1C)/C=C1\[N-]/C(=C\c3[n-]c(c(CCC(=O)O)c3C)/C=c3\[n-]/c(c(C)c3CCC(=O)O)=C\2)[C@@](C)(CC)C1O.[Fe+4] |
| InChI | InChI=1S/C34H38N4O5.Fe/c1-7-20-17(3)24-14-29-33(43)34(6,8-2)30(38-29)16-25-19(5)22(10-12-32(41)42)28(37-25)15-27-21(9-11-31(39)40)18(4)23(36-27)13-26(20)35-24;/h13-16,33,43H,7-12H2,1-6H3,(H,39,40)(H,41,42);/q-4;+4/b23-13-,27-15-,29-14-,30-16-;/t33?,34-;/m1./s1 |
| InChIKey | HDGGIWJGIWBEGK-LBYYCXFRSA-N |
| XLogP | 3.60 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|