C34H33FeN4O5+ — CID 139031326
3-[(17S,18R)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[23H-porphyrin-21-ide-18,2'-oxolane]-2-yl]propanoic acid;iron(2+) (PubChem CID 139031326) has the molecular formula C34H33FeN4O5+ and a molecular weight of 633.51 g/mol. Its IUPAC name is 3-[(17S,18R)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[23H-porphyrin-21-ide-18,2'-oxolane]-2-yl]propanoic acid;iron(2+).
| Compound Name | 3-[(17S,18R)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[23H-porphyrin-21-ide-18,2'-oxolane]-2-yl]propanoic acid;iron(2+) |
|---|---|
| PubChem CID | 139031326 |
| Molecular Formula | C34H33FeN4O5+ |
| Molecular Weight | 633.51 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | 3-[(17S,18R)-8,13-bis(ethenyl)-17-hydroxy-3,7,12,17-tetramethyl-5'-oxospiro[23H-porphyrin-21-ide-18,2'-oxolane]-2-yl]propanoic acid;iron(2+) |
| SMILES | C=CC1=C(C)c2cc3[n-]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5C=C)[C@](C)(O)[C@@]41CCC(=O)O1)c(CCC(=O)O)c3C.[Fe+2] |
| InChI | InChI=1S/C34H34N4O5.Fe/c1-7-20-17(3)23-13-24-19(5)22(9-10-31(39)40)28(37-24)16-30-34(12-11-32(41)43-34)33(6,42)29(38-30)15-27-21(8-2)18(4)25(36-27)14-26(20)35-23;/h7-8,13-16,42H,1-2,9-12H2,3-6H3,(H3,35,36,37,38,39,40);/q;+2/p-1/t33-,34+;/m0./s1 |
| InChIKey | GEESKMPZFOBXLD-XCVPDAMTSA-M |
| XLogP | 5.78 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|