C34H34FeN4O6 — CID 139031485
3-[(17R,18R)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-17,18-dihydroxy-3,7,12,17-tetramethyl-23H-porphyrin-21-id-2-yl]propanoate;iron(2+) (PubChem CID 139031485) has the molecular formula C34H34FeN4O6 and a molecular weight of 650.51 g/mol. Its IUPAC name is 3-[(17R,18R)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-17,18-dihydroxy-3,7,12,17-tetramethyl-23H-porphyrin-21-id-2-yl]propanoate;iron(2+).
| Compound Name | 3-[(17R,18R)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-17,18-dihydroxy-3,7,12,17-tetramethyl-23H-porphyrin-21-id-2-yl]propanoate;iron(2+) |
|---|---|
| PubChem CID | 139031485 |
| Molecular Formula | C34H34FeN4O6 |
| Molecular Weight | 650.51 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 3-[(17R,18R)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-17,18-dihydroxy-3,7,12,17-tetramethyl-23H-porphyrin-21-id-2-yl]propanoate;iron(2+) |
| SMILES | C=CC1=C(C)c2cc3[n-]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5C=C)[C@@](C)(O)[C@@]4(O)CCC(=O)O)c(CCC(=O)[O-])c3C.[Fe+2] |
| InChI | InChI=1S/C34H36N4O6.Fe/c1-7-20-17(3)23-13-24-19(5)22(9-10-31(39)40)28(37-24)16-30-34(44,12-11-32(41)42)33(6,43)29(38-30)15-27-21(8-2)18(4)25(36-27)14-26(20)35-23;/h7-8,13-16,43-44H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/t33-,34-;/m1./s1 |
| InChIKey | GFRHEDKPMCXPFU-YDXXJHAFSA-L |
| XLogP | 3.96 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|