C44H60N6O4+2 — CID 154265465
2-[3-[7,12-bis(ethenyl)-3,8,13,16-tetramethyl-18-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-21,23-dihydro-15H-porphyrin-2-yl]propanoyloxy]ethyl-trimethylazanium (PubChem CID 154265465) has the molecular formula C44H60N6O4+2 and a molecular weight of 737.00 g/mol. Its IUPAC name is 2-[3-[7,12-bis(ethenyl)-3,8,13,16-tetramethyl-18-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-21,23-dihydro-15H-porphyrin-2-yl]propanoyloxy]ethyl-trimethylazanium.
| Compound Name | 2-[3-[7,12-bis(ethenyl)-3,8,13,16-tetramethyl-18-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-21,23-dihydro-15H-porphyrin-2-yl]propanoyloxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 154265465 |
| Molecular Formula | C44H60N6O4+2 |
| Molecular Weight | 737.00 g/mol |
| Exact Mass | 736.47 |
| IUPAC Name | 2-[3-[7,12-bis(ethenyl)-3,8,13,16-tetramethyl-18-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-21,23-dihydro-15H-porphyrin-2-yl]propanoyloxy]ethyl-trimethylazanium |
| SMILES | C=CC1=C(C)C2=Cc3[nH]c(c(C)c3C=C)CC3(C)C=C(CCC(=O)OCC[N+](C)(C)C)C(=N3)C=c3[nH]c(c(C)c3CCC(=O)OCC[N+](C)(C)C)=CC1=N2 |
| InChI | InChI=1S/C44H60N6O4/c1-13-32-28(3)35-23-39-33(14-2)29(4)41(47-39)27-44(6)26-31(15-17-42(51)53-21-19-49(7,8)9)37(48-44)25-40-34(30(5)36(46-40)24-38(32)45-35)16-18-43(52)54-22-20-50(10,11)12/h13-14,23-26,46-47H,1-2,15-22,27H2,3-12H3/q+2 |
| InChIKey | KSGRUITXDBGKEI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.00 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|