C42H42N4NiO2 — CID 21456861
nickel(2+);(E)-[2,7,13,18-tetraethyl-3,8,12,17-tetramethyl-20-[(E)-3-oxoprop-1-enyl]-10-phenylporphyrin-22-id-5-ylidene]methanolate (PubChem CID 21456861) has the molecular formula C42H42N4NiO2 and a molecular weight of 693.52 g/mol. Its IUPAC name is nickel(2+);(E)-[2,7,13,18-tetraethyl-3,8,12,17-tetramethyl-20-[(E)-3-oxoprop-1-enyl]-10-phenylporphyrin-22-id-5-ylidene]methanolate.
| Compound Name | nickel(2+);(E)-[2,7,13,18-tetraethyl-3,8,12,17-tetramethyl-20-[(E)-3-oxoprop-1-enyl]-10-phenylporphyrin-22-id-5-ylidene]methanolate |
|---|---|
| PubChem CID | 21456861 |
| Molecular Formula | C42H42N4NiO2 |
| Molecular Weight | 693.52 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | nickel(2+);(E)-[2,7,13,18-tetraethyl-3,8,12,17-tetramethyl-20-[(E)-3-oxoprop-1-enyl]-10-phenylporphyrin-22-id-5-ylidene]methanolate |
| SMILES | CCC1=C(C)/C2=C/C3=N/C(=C(/c4ccccc4)c4[n-]c(c(CC)c4C)/C(=C\[O-])C4=N/C(=C(/C=C/C=O)C1=N2)C(CC)=C4C)C(C)=C3CC.[Ni+2] |
| InChI | InChI=1S/C42H44N4O2.Ni/c1-9-28-24(6)38-36(27-17-14-13-15-18-27)39-26(8)31(12-4)42(46-39)33(22-48)37-25(7)30(11-3)41(45-37)32(19-16-20-47)40-29(10-2)23(5)34(43-40)21-35(28)44-38;/h13-22H,9-12H2,1-8H3,(H2,43,44,45,46,47,48);/q;+2/p-2/b34-21-,35-21-,37-33-,38-36-,39-36-,40-32-,41-32-,42-33-; |
| InChIKey | UWCWKOZSCFMHQI-JWURLJEYSA-L |
| XLogP | 8.42 |
| TPSA | 91.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.52 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|