C33H35BF2N4O4 — CID 132574803
5-[(Z)-3-[3,4-diethyl-5-(phenylcarbamoyl)-1H-pyrrol-2-yl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]-3,4-diethyl-N-phenyl-1H-pyrrole-2-carboxamide (PubChem CID 132574803) has the molecular formula C33H35BF2N4O4 and a molecular weight of 600.48 g/mol. Its IUPAC name is 5-[(Z)-3-[3,4-diethyl-5-(phenylcarbamoyl)-1H-pyrrol-2-yl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]-3,4-diethyl-N-phenyl-1H-pyrrole-2-carboxamide.
| Compound Name | 5-[(Z)-3-[3,4-diethyl-5-(phenylcarbamoyl)-1H-pyrrol-2-yl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]-3,4-diethyl-N-phenyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 132574803 |
| Molecular Formula | C33H35BF2N4O4 |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 5-[(Z)-3-[3,4-diethyl-5-(phenylcarbamoyl)-1H-pyrrol-2-yl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]-3,4-diethyl-N-phenyl-1H-pyrrole-2-carboxamide |
| SMILES | CCc1c(C(=O)/C=C(\OB(F)F)c2[nH]c(C(=O)Nc3ccccc3)c(CC)c2CC)[nH]c(C(=O)Nc2ccccc2)c1CC |
| InChI | InChI=1S/C33H35BF2N4O4/c1-5-22-24(7-3)30(32(42)37-20-15-11-9-12-16-20)39-28(22)26(41)19-27(44-34(35)36)29-23(6-2)25(8-4)31(40-29)33(43)38-21-17-13-10-14-18-21/h9-19,39-40H,5-8H2,1-4H3,(H,37,42)(H,38,43)/b27-19- |
| InChIKey | KHVBYNYZWMQTMU-DIBXZPPDSA-N |
| XLogP | 7.26 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|