C32H29N3O3S — CID 139044972
methylsulfinylmethane;2-N,5-N,3,4-tetraphenyl-1H-pyrrole-2,5-dicarboxamide (PubChem CID 139044972) has the molecular formula C32H29N3O3S and a molecular weight of 535.67 g/mol. Its IUPAC name is methylsulfinylmethane;2-N,5-N,3,4-tetraphenyl-1H-pyrrole-2,5-dicarboxamide.
| Compound Name | methylsulfinylmethane;2-N,5-N,3,4-tetraphenyl-1H-pyrrole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 139044972 |
| Molecular Formula | C32H29N3O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | methylsulfinylmethane;2-N,5-N,3,4-tetraphenyl-1H-pyrrole-2,5-dicarboxamide |
| SMILES | CS(C)=O.O=C(Nc1ccccc1)c1[nH]c(C(=O)Nc2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H23N3O2.C2H6OS/c34-29(31-23-17-9-3-10-18-23)27-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(33-27)30(35)32-24-19-11-4-12-20-24;1-4(2)3/h1-20,33H,(H,31,34)(H,32,35);1-2H3 |
| InChIKey | VXHPQIBWRUJBMU-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |