C11H11N3O — CID 126500296
5-methyl-N-phenyl-1H-imidazole-2-carboxamide (PubChem CID 126500296) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-methyl-N-phenyl-1H-imidazole-2-carboxamide.
| Compound Name | 5-methyl-N-phenyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 126500296 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-methyl-N-phenyl-1H-imidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H11N3O/c1-8-7-12-10(13-8)11(15)14-9-5-3-2-4-6-9/h2-7H,1H3,(H,12,13)(H,14,15) |
| InChIKey | FNMMIRRVCFBREN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |