C22H24N6O2 — CID 167790037
1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylcarbamoylamino)phenyl]urea (PubChem CID 167790037) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylcarbamoylamino)phenyl]urea.
| Compound Name | 1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 167790037 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylcarbamoylamino)phenyl]urea |
| SMILES | Cc1cnc(C2(NC(=O)Nc3cccc(NC(=O)Nc4ccccc4)c3)CCC2)[nH]1 |
| InChI | InChI=1S/C22H24N6O2/c1-15-14-23-19(24-15)22(11-6-12-22)28-21(30)27-18-10-5-9-17(13-18)26-20(29)25-16-7-3-2-4-8-16/h2-5,7-10,13-14H,6,11-12H2,1H3,(H,23,24)(H2,25,26,29)(H2,27,28,30) |
| InChIKey | MWIOVZCTQZKRDZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |