C21H23N5O3S — CID 166358541
1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylsulfamoyl)phenyl]urea (PubChem CID 166358541) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylsulfamoyl)phenyl]urea.
| Compound Name | 1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 166358541 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-[3-(phenylsulfamoyl)phenyl]urea |
| SMILES | Cc1cnc(C2(NC(=O)Nc3cccc(S(=O)(=O)Nc4ccccc4)c3)CCC2)[nH]1 |
| InChI | InChI=1S/C21H23N5O3S/c1-15-14-22-19(23-15)21(11-6-12-21)25-20(27)24-17-9-5-10-18(13-17)30(28,29)26-16-7-3-2-4-8-16/h2-5,7-10,13-14,26H,6,11-12H2,1H3,(H,22,23)(H2,24,25,27) |
| InChIKey | CZACXBSCDNWLSH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |