C13H17N5O2 — CID 167815780
2-methyl-N-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-oxo-1H-pyrazole-5-carboxamide (PubChem CID 167815780) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-methyl-N-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-oxo-1H-pyrazole-5-carboxamide.
| Compound Name | 2-methyl-N-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-oxo-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167815780 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-methyl-N-[1-(5-methyl-1H-imidazol-2-yl)cyclobutyl]-3-oxo-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cnc(C2(NC(=O)c3cc(=O)n(C)[nH]3)CCC2)[nH]1 |
| InChI | InChI=1S/C13H17N5O2/c1-8-7-14-12(15-8)13(4-3-5-13)16-11(20)9-6-10(19)18(2)17-9/h6-7,17H,3-5H2,1-2H3,(H,14,15)(H,16,20) |
| InChIKey | VNUAEXKFAUNXAW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |