C18H29N3O — CID 145236720
ethane;2-methyl-N-phenyl-1H-imidazole-5-carboxamide;prop-1-ene (PubChem CID 145236720) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is ethane;2-methyl-N-phenyl-1H-imidazole-5-carboxamide;prop-1-ene.
| Compound Name | ethane;2-methyl-N-phenyl-1H-imidazole-5-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 145236720 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | ethane;2-methyl-N-phenyl-1H-imidazole-5-carboxamide;prop-1-ene |
| SMILES | C=CC.CC.CC.Cc1ncc(C(=O)Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H11N3O.C3H6.2C2H6/c1-8-12-7-10(13-8)11(15)14-9-5-3-2-4-6-9;1-3-2;2*1-2/h2-7H,1H3,(H,12,13)(H,14,15);3H,1H2,2H3;2*1-2H3 |
| InChIKey | NEWHEHCHVXPZRP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|