C26H23FN2O — CID 67810606
5-(2-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide (PubChem CID 67810606) has the molecular formula C26H23FN2O and a molecular weight of 398.48 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67810606 |
| Molecular Formula | C26H23FN2O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-(2-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide |
| SMILES | CC(C)c1[nH]c(-c2ccccc2F)c(-c2ccccc2)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H23FN2O/c1-17(2)24-23(26(30)28-19-13-7-4-8-14-19)22(18-11-5-3-6-12-18)25(29-24)20-15-9-10-16-21(20)27/h3-17,29H,1-2H3,(H,28,30) |
| InChIKey | XEBJKFLOIKZJBH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |