C32H34F2N2O6 — CID 11956561
N,5-bis(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 11956561) has the molecular formula C32H34F2N2O6 and a molecular weight of 580.63 g/mol. Its IUPAC name is N,5-bis(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | N,5-bis(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11956561 |
| Molecular Formula | C32H34F2N2O6 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | N,5-bis(4-fluorophenyl)-1-[(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccc(F)cc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1C[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C32H34F2N2O6/c1-18(2)28-27(32(42)35-23-14-12-22(34)13-15-23)26(19-6-4-3-5-7-19)29(20-8-10-21(33)11-9-20)36(28)16-24(38)30(40)31(41)25(39)17-37/h3-15,18,24-25,30-31,37-41H,16-17H2,1-2H3,(H,35,42)/t24-,25-,30+,31+/m0/s1 |
| InChIKey | BYONMSQIXVTNSM-NZWZHHCMSA-N |
| XLogP | 3.91 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |