C20H20N2O2 — CID 140995763
1-hydroxy-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 140995763) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-hydroxy-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 1-hydroxy-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 140995763 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-hydroxy-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)cn1O |
| InChI | InChI=1S/C20H20N2O2/c1-14(2)19-18(20(23)21-16-11-7-4-8-12-16)17(13-22(19)24)15-9-5-3-6-10-15/h3-14,24H,1-2H3,(H,21,23) |
| InChIKey | RPYSKCISBPSDHX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|