C41H45N3O2 — CID 67841180
1-[7-(dibenzylamino)-7-oxoheptyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 67841180) has the molecular formula C41H45N3O2 and a molecular weight of 611.83 g/mol. Its IUPAC name is 1-[7-(dibenzylamino)-7-oxoheptyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 1-[7-(dibenzylamino)-7-oxoheptyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67841180 |
| Molecular Formula | C41H45N3O2 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 1-[7-(dibenzylamino)-7-oxoheptyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)cn1CCCCCCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C41H45N3O2/c1-32(2)40-39(41(46)42-36-25-15-8-16-26-36)37(35-23-13-7-14-24-35)31-43(40)28-18-4-3-17-27-38(45)44(29-33-19-9-5-10-20-33)30-34-21-11-6-12-22-34/h5-16,19-26,31-32H,3-4,17-18,27-30H2,1-2H3,(H,42,46) |
| InChIKey | VTKXIMZCUYUNMB-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|