C25H28BF2IN2O2 — CID 102526667
(Z)-3-(3,4-diethyl-5-iodo-1H-pyrrol-2-yl)-1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-difluoroboranyloxyprop-2-en-1-one (PubChem CID 102526667) has the molecular formula C25H28BF2IN2O2 and a molecular weight of 564.22 g/mol. Its IUPAC name is (Z)-3-(3,4-diethyl-5-iodo-1H-pyrrol-2-yl)-1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-difluoroboranyloxyprop-2-en-1-one.
| Compound Name | (Z)-3-(3,4-diethyl-5-iodo-1H-pyrrol-2-yl)-1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-difluoroboranyloxyprop-2-en-1-one |
|---|---|
| PubChem CID | 102526667 |
| Molecular Formula | C25H28BF2IN2O2 |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | (Z)-3-(3,4-diethyl-5-iodo-1H-pyrrol-2-yl)-1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-difluoroboranyloxyprop-2-en-1-one |
| SMILES | CCc1c(I)[nH]c(/C(=C/C(=O)c2[nH]c(-c3ccccc3)c(CC)c2CC)OB(F)F)c1CC |
| InChI | InChI=1S/C25H28BF2IN2O2/c1-5-16-17(6-2)23(30-22(16)15-12-10-9-11-13-15)20(32)14-21(33-26(27)28)24-18(7-3)19(8-4)25(29)31-24/h9-14,30-31H,5-8H2,1-4H3/b21-14- |
| InChIKey | KHTSFFIEGDENMR-STZFKDTASA-N |
| XLogP | 7.03 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|