C19H15NO3 — CID 12559936
methyl 3-phenyl-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate (PubChem CID 12559936) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl 3-phenyl-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate.
| Compound Name | methyl 3-phenyl-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 12559936 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | methyl 3-phenyl-1,4-dihydrochromeno[4,3-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2c(c1-c1ccccc1)COc1ccccc1-2 |
| InChI | InChI=1S/C19H15NO3/c1-22-19(21)18-16(12-7-3-2-4-8-12)14-11-23-15-10-6-5-9-13(15)17(14)20-18/h2-10,20H,11H2,1H3 |
| InChIKey | VHTGJSZBNBTXID-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |