C25H22N2O4 — CID 102394420
1,3-bis[5-(2-methoxyphenyl)-1H-pyrrol-2-yl]propane-1,3-dione (PubChem CID 102394420) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1,3-bis[5-(2-methoxyphenyl)-1H-pyrrol-2-yl]propane-1,3-dione.
| Compound Name | 1,3-bis[5-(2-methoxyphenyl)-1H-pyrrol-2-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 102394420 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1,3-bis[5-(2-methoxyphenyl)-1H-pyrrol-2-yl]propane-1,3-dione |
| SMILES | COc1ccccc1-c1ccc(C(=O)CC(=O)c2ccc(-c3ccccc3OC)[nH]2)[nH]1 |
| InChI | InChI=1S/C25H22N2O4/c1-30-24-9-5-3-7-16(24)18-11-13-20(26-18)22(28)15-23(29)21-14-12-19(27-21)17-8-4-6-10-25(17)31-2/h3-14,26-27H,15H2,1-2H3 |
| InChIKey | ZVBPYKCPOKDFOV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|