C15H20ClN3O — CID 119497081
N-(3-aminobutyl)-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 119497081) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is N-(3-aminobutyl)-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119497081 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-(3-aminobutyl)-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1ccc(-c2ccccc2)[nH]1.Cl |
| InChI | InChI=1S/C15H19N3O.ClH/c1-11(16)9-10-17-15(19)14-8-7-13(18-14)12-5-3-2-4-6-12;/h2-8,11,18H,9-10,16H2,1H3,(H,17,19);1H |
| InChIKey | BRGHFYBGOZTBNN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |