C11H10N2O2 — CID 117223058
5-(4-aminophenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 117223058) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-(4-aminophenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-(4-aminophenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 117223058 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-(4-aminophenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | Nc1ccc(-c2ccc(C(=O)O)[nH]2)cc1 |
| InChI | InChI=1S/C11H10N2O2/c12-8-3-1-7(2-4-8)9-5-6-10(13-9)11(14)15/h1-6,13H,12H2,(H,14,15) |
| InChIKey | VBUMEDRYZOVUJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|