C30H29N5 — CID 142315294
4-N-[4-[5-[4-(4-amino-N-methylanilino)phenyl]-1H-pyrrol-2-yl]phenyl]-4-N-methylbenzene-1,4-diamine (PubChem CID 142315294) has the molecular formula C30H29N5 and a molecular weight of 459.60 g/mol. Its IUPAC name is 4-N-[4-[5-[4-(4-amino-N-methylanilino)phenyl]-1H-pyrrol-2-yl]phenyl]-4-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-[5-[4-(4-amino-N-methylanilino)phenyl]-1H-pyrrol-2-yl]phenyl]-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142315294 |
| Molecular Formula | C30H29N5 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4-N-[4-[5-[4-(4-amino-N-methylanilino)phenyl]-1H-pyrrol-2-yl]phenyl]-4-N-methylbenzene-1,4-diamine |
| SMILES | CN(c1ccc(N)cc1)c1ccc(-c2ccc(-c3ccc(N(C)c4ccc(N)cc4)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C30H29N5/c1-34(27-15-7-23(31)8-16-27)25-11-3-21(4-12-25)29-19-20-30(33-29)22-5-13-26(14-6-22)35(2)28-17-9-24(32)10-18-28/h3-20,33H,31-32H2,1-2H3 |
| InChIKey | ODCZLTBMYGGGOM-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 74.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|