C20H23N3O2 — CID 86779911
3,7-dimethyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1-benzofuran-2-carboxamide (PubChem CID 86779911) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3,7-dimethyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3,7-dimethyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 86779911 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3,7-dimethyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCNCc2cccnc2)oc2c(C)cccc12 |
| InChI | InChI=1S/C20H23N3O2/c1-14-6-3-8-17-15(2)19(25-18(14)17)20(24)23-11-5-10-22-13-16-7-4-9-21-12-16/h3-4,6-9,12,22H,5,10-11,13H2,1-2H3,(H,23,24) |
| InChIKey | VCSCUBZAKKIEKF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|