C15H17NO4S — CID 119242689
2-[2-[(3,7-dimethyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 119242689) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[2-[(3,7-dimethyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3,7-dimethyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242689 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[2-[(3,7-dimethyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1c(C(=O)NCCSCC(=O)O)oc2c(C)cccc12 |
| InChI | InChI=1S/C15H17NO4S/c1-9-4-3-5-11-10(2)14(20-13(9)11)15(19)16-6-7-21-8-12(17)18/h3-5H,6-8H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | XJRXOXRMGMEZJK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|