C14H13NO2 — CID 47366244
3,7-dimethyl-N-prop-2-ynyl-1-benzofuran-2-carboxamide (PubChem CID 47366244) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3,7-dimethyl-N-prop-2-ynyl-1-benzofuran-2-carboxamide.
| Compound Name | 3,7-dimethyl-N-prop-2-ynyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 47366244 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3,7-dimethyl-N-prop-2-ynyl-1-benzofuran-2-carboxamide |
| SMILES | C#CCNC(=O)c1oc2c(C)cccc2c1C |
| InChI | InChI=1S/C14H13NO2/c1-4-8-15-14(16)13-10(3)11-7-5-6-9(2)12(11)17-13/h1,5-7H,8H2,2-3H3,(H,15,16) |
| InChIKey | AJGZNQBLVOSALF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|