C21H23NO4 — CID 122132125
N-[[4-(dimethoxymethyl)phenyl]methyl]-3,7-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 122132125) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[[4-(dimethoxymethyl)phenyl]methyl]-3,7-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(dimethoxymethyl)phenyl]methyl]-3,7-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 122132125 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[[4-(dimethoxymethyl)phenyl]methyl]-3,7-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | COC(OC)c1ccc(CNC(=O)c2oc3c(C)cccc3c2C)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-13-6-5-7-17-14(2)19(26-18(13)17)20(23)22-12-15-8-10-16(11-9-15)21(24-3)25-4/h5-11,21H,12H2,1-4H3,(H,22,23) |
| InChIKey | OBRFOTZREBIZEU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|