C19H17ClN4O2S — CID 57436476
N-[2-[(5-chloro-1,2-benzothiazol-3-yl)amino]ethyl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 57436476) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[2-[(5-chloro-1,2-benzothiazol-3-yl)amino]ethyl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-[(5-chloro-1,2-benzothiazol-3-yl)amino]ethyl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 57436476 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[2-[(5-chloro-1,2-benzothiazol-3-yl)amino]ethyl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NCCNc3nsc4ccc(Cl)cc34)cc2c1 |
| InChI | InChI=1S/C19H17ClN4O2S/c1-26-13-3-4-15-11(8-13)9-16(23-15)19(25)22-7-6-21-18-14-10-12(20)2-5-17(14)27-24-18/h2-5,8-10,23H,6-7H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | SSMDACNDMJKNPN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|