C25H26N6OS — CID 11854994
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(4-phenylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 11854994) has the molecular formula C25H26N6OS and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(4-phenylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(4-phenylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11854994 |
| Molecular Formula | C25H26N6OS |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(4-phenylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | O=C(NCCNc1nsc2ccccc12)c1cc(N2CCN(c3ccccc3)CC2)ccn1 |
| InChI | InChI=1S/C25H26N6OS/c32-25(28-13-12-27-24-21-8-4-5-9-23(21)33-29-24)22-18-20(10-11-26-22)31-16-14-30(15-17-31)19-6-2-1-3-7-19/h1-11,18H,12-17H2,(H,27,29)(H,28,32) |
| InChIKey | GZBKQVVBSUSQRF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|